ID | 1703 |
Name | Cephaelin |
Pubchem ID | 442195 |
KEGG ID | C09390 |
Source | Cephaelis ipecacuanha |
Type | Natural |
Function | Anti-amoebic |
Drug Like Properties | Yes |
Molecular Weight | 466.61 |
Exact mass | 466.283158 |
Molecular formula | C28H38N2O4 |
XlogP | 4.4 |
Topological Polar Surface Area | 63.2 |
H-Bond Donor | 2 |
H-Bond Acceptor | 6 |
Rotational Bond Count | 6 |
IUPAC Name | (1R)-1-[[(2S,3R,11bS)-3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-pyrido[2,1-a]isoquinolin-2-yl]methyl]-7-methoxy-1,2,3,4-tetrahydroisoquinolin-6-ol |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CCC1CN2CCC3=CC(=C(C=C3C2CC1CC4C5=CC(=C(C=C5CCN4)O)OC)OC)OC |
Isomeric SMILE | CC[C@H]1CN2CCC3=CC(=C(C=C3[C@@H]2C[C@@H]1C[C@@H]4C5=CC(=C(C=C5CCN4)O)OC)OC)OC |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
ID | 1718 |
Name | Cephaelin |
Pubchem ID | 442195 |
KEGG ID | C09390 |
Source | Cephaelis ipecacuanha |
Type | Natural |
Function | Protein synthesis inhibitor |
Drug Like Properties | Yes |
Molecular Weight | 466.61 |
Exact mass | 466.283158 |
Molecular formula | C28H38N2O4 |
XlogP | 4.4 |
Topological Polar Surface Area | 63.2 |
H-Bond Donor | 2 |
H-Bond Acceptor | 6 |
Rotational Bond Count | 6 |
IUPAC Name | (1R)-1-[[(2S,3R,11bS)-3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-pyrido[2,1-a]isoquinolin-2-yl]methyl]-7-methoxy-1,2,3,4-tetrahydroisoquinolin-6-ol |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CCC1CN2CCC3=CC(=C(C=C3C2CC1CC4C5=CC(=C(C=C5CCN4)O)OC)OC)OC |
Isomeric SMILE | CC[C@H]1CN2CCC3=CC(=C(C=C3[C@@H]2C[C@@H]1C[C@@H]4C5=CC(=C(C=C5CCN4)O)OC)OC)OC |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
ID | 2061 |
Name | Emetamine |
Pubchem ID | 442217 |
KEGG ID | C09420 |
Source | Cephaelis ipecacuanha |
Type | Natural |
Function | Expectorant |
Drug Like Properties | No |
Molecular Weight | 476.61 |
Exact mass | 476.267508 |
Molecular formula | C29H36N2O4 |
XlogP | 5.4 |
Topological Polar Surface Area | 53.1 |
H-Bond Donor | 0 |
H-Bond Acceptor | 6 |
Rotational Bond Count | 7 |
IUPAC Name | (2R,3R,11bS)-2-[(6,7-dimethoxyisoquinolin-1-yl)methyl]-3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-pyrido[2,1-a]isoquinoline |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CCC1CN2CCC3=CC(=C(C=C3C2CC1CC4=NC=CC5=CC(=C(C=C54)OC)OC)OC)OC |
Isomeric SMILE | CC[C@H]1CN2CCC3=CC(=C(C=C3[C@@H]2C[C@@H]1CC4=NC=CC5=CC(=C(C=C54)OC)OC)OC)OC |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
ID | 2063 |
Name | Emetamine |
Pubchem ID | 442217 |
KEGG ID | C09420 |
Source | Cephaelis ipecacuanha |
Type | Natural |
Function | Emetic |
Drug Like Properties | No |
Molecular Weight | 476.61 |
Exact mass | 476.267508 |
Molecular formula | C29H36N2O4 |
XlogP | 5.4 |
Topological Polar Surface Area | 53.1 |
H-Bond Donor | 0 |
H-Bond Acceptor | 6 |
Rotational Bond Count | 7 |
IUPAC Name | (2R,3R,11bS)-2-[(6,7-dimethoxyisoquinolin-1-yl)methyl]-3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-pyrido[2,1-a]isoquinoline |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CCC1CN2CCC3=CC(=C(C=C3C2CC1CC4=NC=CC5=CC(=C(C=C54)OC)OC)OC)OC |
Isomeric SMILE | CC[C@H]1CN2CCC3=CC(=C(C=C3[C@@H]2C[C@@H]1CC4=NC=CC5=CC(=C(C=C54)OC)OC)OC)OC |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
ID | 2065 |
Name | Emetamine |
Pubchem ID | 442217 |
KEGG ID | C09420 |
Source | Cephaelis ipecacuanha |
Type | Natural |
Function | Anti-amoebic |
Drug Like Properties | No |
Molecular Weight | 476.61 |
Exact mass | 476.267508 |
Molecular formula | C29H36N2O4 |
XlogP | 5.4 |
Topological Polar Surface Area | 53.1 |
H-Bond Donor | 0 |
H-Bond Acceptor | 6 |
Rotational Bond Count | 7 |
IUPAC Name | (2R,3R,11bS)-2-[(6,7-dimethoxyisoquinolin-1-yl)methyl]-3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-pyrido[2,1-a]isoquinoline |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CCC1CN2CCC3=CC(=C(C=C3C2CC1CC4=NC=CC5=CC(=C(C=C54)OC)OC)OC)OC |
Isomeric SMILE | CC[C@H]1CN2CCC3=CC(=C(C=C3[C@@H]2C[C@@H]1CC4=NC=CC5=CC(=C(C=C54)OC)OC)OC)OC |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
ID | 2070 |
Name | Emetine |
Pubchem ID | 10219 |
KEGG ID | C09421 |
Source | Cephaelis ipecacuanha |
Type | Natural |
Function | Antiprotozoal |
Drug Like Properties | Yes |
Molecular Weight | 480.64 |
Exact mass | 480.298808 |
Molecular formula | C29H40N2O4 |
XlogP | 4.7 |
Topological Polar Surface Area | 52.2 |
H-Bond Donor | 1 |
H-Bond Acceptor | 6 |
Rotational Bond Count | 7 |
IUPAC Name | (2S,3R,11bS)-2-[[(1R)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]-3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-pyrido[2,1-a]isoquinoline |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CCC1CN2CCC3=CC(=C(C=C3C2CC1CC4C5=CC(=C(C=C5CCN4)OC)OC)OC)OC |
Isomeric SMILE | CC[C@H]1CN2CCC3=CC(=C(C=C3[C@@H]2C[C@@H]1C[C@@H]4C5=CC(=C(C=C5CCN4)OC)OC)OC)OC |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
ID | 2075 |
Name | Emetine |
Pubchem ID | 10219 |
KEGG ID | C09421 |
Source | Cephaelis ipecacuanha |
Type | Natural |
Function | Antiparasitic |
Drug Like Properties | Yes |
Molecular Weight | 480.64 |
Exact mass | 480.298808 |
Molecular formula | C29H40N2O4 |
XlogP | 4.7 |
Topological Polar Surface Area | 52.2 |
H-Bond Donor | 1 |
H-Bond Acceptor | 6 |
Rotational Bond Count | 7 |
IUPAC Name | (2S,3R,11bS)-2-[[(1R)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]-3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-pyrido[2,1-a]isoquinoline |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CCC1CN2CCC3=CC(=C(C=C3C2CC1CC4C5=CC(=C(C=C5CCN4)OC)OC)OC)OC |
Isomeric SMILE | CC[C@H]1CN2CCC3=CC(=C(C=C3[C@@H]2C[C@@H]1C[C@@H]4C5=CC(=C(C=C5CCN4)OC)OC)OC)OC |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
ID | 2080 |
Name | Emetine |
Pubchem ID | 10219 |
KEGG ID | C09421 |
Source | Cephaelis ipecacuanha |
Type | Natural |
Function | Protein synthesis inhibitor |
Drug Like Properties | Yes |
Molecular Weight | 480.64 |
Exact mass | 480.298808 |
Molecular formula | C29H40N2O4 |
XlogP | 4.7 |
Topological Polar Surface Area | 52.2 |
H-Bond Donor | 1 |
H-Bond Acceptor | 6 |
Rotational Bond Count | 7 |
IUPAC Name | (2S,3R,11bS)-2-[[(1R)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]-3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-pyrido[2,1-a]isoquinoline |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CCC1CN2CCC3=CC(=C(C=C3C2CC1CC4C5=CC(=C(C=C5CCN4)OC)OC)OC)OC |
Isomeric SMILE | CC[C@H]1CN2CCC3=CC(=C(C=C3[C@@H]2C[C@@H]1C[C@@H]4C5=CC(=C(C=C5CCN4)OC)OC)OC)OC |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
ID | 2085 |
Name | Emetine |
Pubchem ID | 10219 |
KEGG ID | C09421 |
Source | Cephaelis ipecacuanha |
Type | Natural |
Function | Anticancer |
Drug Like Properties | Yes |
Molecular Weight | 480.64 |
Exact mass | 480.298808 |
Molecular formula | C29H40N2O4 |
XlogP | 4.7 |
Topological Polar Surface Area | 52.2 |
H-Bond Donor | 1 |
H-Bond Acceptor | 6 |
Rotational Bond Count | 7 |
IUPAC Name | (2S,3R,11bS)-2-[[(1R)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]-3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-pyrido[2,1-a]isoquinoline |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CCC1CN2CCC3=CC(=C(C=C3C2CC1CC4C5=CC(=C(C=C5CCN4)OC)OC)OC)OC |
Isomeric SMILE | CC[C@H]1CN2CCC3=CC(=C(C=C3[C@@H]2C[C@@H]1C[C@@H]4C5=CC(=C(C=C5CCN4)OC)OC)OC)OC |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
ID | 2090 |
Name | Emetine |
Pubchem ID | 10219 |
KEGG ID | C09421 |
Source | Cephaelis ipecacuanha |
Type | Natural |
Function | Cytotoxic |
Drug Like Properties | Yes |
Molecular Weight | 480.64 |
Exact mass | 480.298808 |
Molecular formula | C29H40N2O4 |
XlogP | 4.7 |
Topological Polar Surface Area | 52.2 |
H-Bond Donor | 1 |
H-Bond Acceptor | 6 |
Rotational Bond Count | 7 |
IUPAC Name | (2S,3R,11bS)-2-[[(1R)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]-3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-pyrido[2,1-a]isoquinoline |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CCC1CN2CCC3=CC(=C(C=C3C2CC1CC4C5=CC(=C(C=C5CCN4)OC)OC)OC)OC |
Isomeric SMILE | CC[C@H]1CN2CCC3=CC(=C(C=C3[C@@H]2C[C@@H]1C[C@@H]4C5=CC(=C(C=C5CCN4)OC)OC)OC)OC |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
ID | 2095 |
Name | Emetine |
Pubchem ID | 10219 |
KEGG ID | C09421 |
Source | Cephaelis ipecacuanha |
Type | Natural |
Function | Antiviral |
Drug Like Properties | Yes |
Molecular Weight | 480.64 |
Exact mass | 480.298808 |
Molecular formula | C29H40N2O4 |
XlogP | 4.7 |
Topological Polar Surface Area | 52.2 |
H-Bond Donor | 1 |
H-Bond Acceptor | 6 |
Rotational Bond Count | 7 |
IUPAC Name | (2S,3R,11bS)-2-[[(1R)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]-3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-pyrido[2,1-a]isoquinoline |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CCC1CN2CCC3=CC(=C(C=C3C2CC1CC4C5=CC(=C(C=C5CCN4)OC)OC)OC)OC |
Isomeric SMILE | CC[C@H]1CN2CCC3=CC(=C(C=C3[C@@H]2C[C@@H]1C[C@@H]4C5=CC(=C(C=C5CCN4)OC)OC)OC)OC |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
ID | 3034 |
Name | Psychotrine |
Pubchem ID | 5462438 |
KEGG ID | C09612 |
Source | Cephaelis ipecacuanha |
Type | Natural |
Function | Anti-amoebic |
Drug Like Properties | Yes |
Molecular Weight | 464.60 |
Exact mass | 464.267508 |
Molecular formula | C28H36N2O4 |
XlogP | 4 |
Topological Polar Surface Area | 60 |
H-Bond Donor | 1 |
H-Bond Acceptor | 6 |
Rotational Bond Count | 6 |
IUPAC Name | 1-[[(2R,3R,11bS)-3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-pyrido[2,1-a]isoquinolin-2-yl]methyl]-7-methoxy-3,4-dihydro-2H-isoquinolin-6-one |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | CCC1CN2CCC3=CC(=C(C=C3C2CC1CC4=C5C=C(C(=O)C=C5CCN4)OC)OC)OC |
Isomeric SMILE | CC[C@H]1CN2CCC3=CC(=C(C=C3[C@@H]2C[C@@H]1CC4=C5C=C(C(=O)C=C5CCN4)OC)OC)OC |
Drugpedia | wiki |
References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |